C13H20O6 — CID 13212861
[(2R,3R,4R)-3,4-diacetyloxyhept-6-en-2-yl] acetate (PubChem CID 13212861) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-diacetyloxyhept-6-en-2-yl] acetate.
| Compound Name | [(2R,3R,4R)-3,4-diacetyloxyhept-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 13212861 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [(2R,3R,4R)-3,4-diacetyloxyhept-6-en-2-yl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C13H20O6/c1-6-7-12(18-10(4)15)13(19-11(5)16)8(2)17-9(3)14/h6,8,12-13H,1,7H2,2-5H3/t8-,12-,13-/m1/s1 |
| InChIKey | JVACTWUGGKSWPC-BZHVJNSISA-N |
| XLogP | 1.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|