N-phenylbenzenecarboximidoyl fluoride

C13H10FN — CID 13213151

IUPACN-phenylbenzenecarboximidoyl fluoride
SMILESF/C(=N\c1ccccc1)c1ccccc1
InChIInChI=1S/C13H10FN/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H/b15-13-
InChIKeyMLUAGQHMNVXDGS-SQFISAMPSA-N
MW199.23 g/mol
LogP3.73
Rot. Bonds2

About N-phenylbenzenecarboximidoyl fluoride

N-phenylbenzenecarboximidoyl fluoride (PubChem CID 13213151) has the molecular formula C13H10FN and a molecular weight of 199.23 g/mol. Its IUPAC name is N-phenylbenzenecarboximidoyl fluoride.

Molecular Properties

Compound NameN-phenylbenzenecarboximidoyl fluoride
PubChem CID13213151
Molecular FormulaC13H10FN
Molecular Weight199.23 g/mol
Exact Mass199.08
IUPAC NameN-phenylbenzenecarboximidoyl fluoride
SMILESF/C(=N\c1ccccc1)c1ccccc1
InChIInChI=1S/C13H10FN/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H/b15-13-
InChIKeyMLUAGQHMNVXDGS-SQFISAMPSA-N
XLogP3.73
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.23
LogP ≤ 53.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-phenylbenzenecarboximidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-phenylbenzenecarboximidoyl fluoride?
The IUPAC name of N-phenylbenzenecarboximidoyl fluoride (CID 13213151) is N-phenylbenzenecarboximidoyl fluoride.
What is the SMILES notation for N-phenylbenzenecarboximidoyl fluoride?
The canonical SMILES for N-phenylbenzenecarboximidoyl fluoride is F/C(=N\c1ccccc1)c1ccccc1.
What is the InChIKey of N-phenylbenzenecarboximidoyl fluoride?
The InChIKey is MLUAGQHMNVXDGS-SQFISAMPSA-N. The full InChI is InChI=1S/C13H10FN/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H/b15-13-.
What are the key properties of N-phenylbenzenecarboximidoyl fluoride?
N-phenylbenzenecarboximidoyl fluoride has a molecular weight of 199.23 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylbenzenecarboximidoyl fluoride is sourced from PubChem (CID 13213151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).