About 1-ethyl-1-pentylurea
1-ethyl-1-pentylurea (PubChem CID 13213309) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 1-ethyl-1-pentylurea.
Molecular Properties
| Compound Name | 1-ethyl-1-pentylurea |
| PubChem CID | 13213309 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1-ethyl-1-pentylurea |
| SMILES | CCCCCN(CC)C(N)=O |
| InChI | InChI=1S/C8H18N2O/c1-3-5-6-7-10(4-2)8(9)11/h3-7H2,1-2H3,(H2,9,11) |
| InChIKey | VVOVNQGXHMDMEE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-pentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-pentylurea?
The IUPAC name of 1-ethyl-1-pentylurea (CID 13213309) is 1-ethyl-1-pentylurea.
What is the SMILES notation for 1-ethyl-1-pentylurea?
The canonical SMILES for 1-ethyl-1-pentylurea is CCCCCN(CC)C(N)=O.
What is the InChIKey of 1-ethyl-1-pentylurea?
The InChIKey is VVOVNQGXHMDMEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-3-5-6-7-10(4-2)8(9)11/h3-7H2,1-2H3,(H2,9,11).
What are the key properties of 1-ethyl-1-pentylurea?
1-ethyl-1-pentylurea has a molecular weight of 158.25 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-pentylurea is sourced from PubChem (CID 13213309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).