About 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane
2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane (PubChem CID 13213660) has the molecular formula C19H28O4SSi
and a molecular weight of 380.58 g/mol. Its IUPAC name is 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane |
| PubChem CID | 13213660 |
| Molecular Formula | C19H28O4SSi |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCC1CC2(CC=C1S(=O)(=O)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C19H28O4SSi/c1-25(2,3)14-10-16-15-19(22-12-13-23-19)11-9-18(16)24(20,21)17-7-5-4-6-8-17/h4-9,16H,10-15H2,1-3H3 |
| InChIKey | OIJNPOYKTRPLIO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane?
The IUPAC name of 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane (CID 13213660) is 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane.
What is the SMILES notation for 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane?
The canonical SMILES for 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane is C[Si](C)(C)CCC1CC2(CC=C1S(=O)(=O)c1ccccc1)OCCO2.
What is the InChIKey of 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane?
The InChIKey is OIJNPOYKTRPLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O4SSi/c1-25(2,3)14-10-16-15-19(22-12-13-23-19)11-9-18(16)24(20,21)17-7-5-4-6-8-17/h4-9,16H,10-15H2,1-3H3.
What are the key properties of 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane?
2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane has a molecular weight of 380.58 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[8-(benzenesulfonyl)-1,4-dioxaspiro[4.5]dec-8-en-7-yl]ethyl-trimethylsilane is sourced from PubChem (CID 13213660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).