About 1-butoxy-3-chlorobutane
1-butoxy-3-chlorobutane (PubChem CID 13213747) has the molecular formula C8H17ClO
and a molecular weight of 164.68 g/mol. Its IUPAC name is 1-butoxy-3-chlorobutane.
Molecular Properties
| Compound Name | 1-butoxy-3-chlorobutane |
| PubChem CID | 13213747 |
| Molecular Formula | C8H17ClO |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1-butoxy-3-chlorobutane |
| SMILES | CCCCOCCC(C)Cl |
| InChI | InChI=1S/C8H17ClO/c1-3-4-6-10-7-5-8(2)9/h8H,3-7H2,1-2H3 |
| InChIKey | HBAKSTWZHDOWKD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-3-chlorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-3-chlorobutane?
The IUPAC name of 1-butoxy-3-chlorobutane (CID 13213747) is 1-butoxy-3-chlorobutane.
What is the SMILES notation for 1-butoxy-3-chlorobutane?
The canonical SMILES for 1-butoxy-3-chlorobutane is CCCCOCCC(C)Cl.
What is the InChIKey of 1-butoxy-3-chlorobutane?
The InChIKey is HBAKSTWZHDOWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17ClO/c1-3-4-6-10-7-5-8(2)9/h8H,3-7H2,1-2H3.
What are the key properties of 1-butoxy-3-chlorobutane?
1-butoxy-3-chlorobutane has a molecular weight of 164.68 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-3-chlorobutane is sourced from PubChem (CID 13213747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).