C34H26N4O3 — CID 13213807
2,3-bis(2,2-diphenylhydrazinyl)-5-hydroxynaphthalene-1,4-dione (PubChem CID 13213807) has the molecular formula C34H26N4O3 and a molecular weight of 538.61 g/mol. Its IUPAC name is 2,3-bis(2,2-diphenylhydrazinyl)-5-hydroxynaphthalene-1,4-dione.
| Compound Name | 2,3-bis(2,2-diphenylhydrazinyl)-5-hydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 13213807 |
| Molecular Formula | C34H26N4O3 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 2,3-bis(2,2-diphenylhydrazinyl)-5-hydroxynaphthalene-1,4-dione |
| SMILES | O=C1C(NN(c2ccccc2)c2ccccc2)=C(NN(c2ccccc2)c2ccccc2)C(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C34H26N4O3/c39-29-23-13-22-28-30(29)34(41)32(36-38(26-18-9-3-10-19-26)27-20-11-4-12-21-27)31(33(28)40)35-37(24-14-5-1-6-15-24)25-16-7-2-8-17-25/h1-23,35-36,39H |
| InChIKey | KRMNLIUVMIITMX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|