C17H24O3S — CID 13213887
[(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl 4-methylbenzenesulfonate (PubChem CID 13213887) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is [(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13213887 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [(1R,2R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CC[C@@H]3C[C@H]2C3(C)C)cc1 |
| InChI | InChI=1S/C17H24O3S/c1-12-4-8-15(9-5-12)21(18,19)20-11-13-6-7-14-10-16(13)17(14,2)3/h4-5,8-9,13-14,16H,6-7,10-11H2,1-3H3/t13-,14+,16+/m0/s1 |
| InChIKey | AZEIDOGKGJVTCE-SQWLQELKSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|