About (3S)-2,2-dimethylnon-4-yn-3-ol
(3S)-2,2-dimethylnon-4-yn-3-ol (PubChem CID 13213901) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (3S)-2,2-dimethylnon-4-yn-3-ol.
Molecular Properties
| Compound Name | (3S)-2,2-dimethylnon-4-yn-3-ol |
| PubChem CID | 13213901 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3S)-2,2-dimethylnon-4-yn-3-ol |
| SMILES | CCCCC#C[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C11H20O/c1-5-6-7-8-9-10(12)11(2,3)4/h10,12H,5-7H2,1-4H3/t10-/m1/s1 |
| InChIKey | SDKKYLSROCBCSF-SNVBAGLBSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,2-dimethylnon-4-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,2-dimethylnon-4-yn-3-ol?
The IUPAC name of (3S)-2,2-dimethylnon-4-yn-3-ol (CID 13213901) is (3S)-2,2-dimethylnon-4-yn-3-ol.
What is the SMILES notation for (3S)-2,2-dimethylnon-4-yn-3-ol?
The canonical SMILES for (3S)-2,2-dimethylnon-4-yn-3-ol is CCCCC#C[C@@H](O)C(C)(C)C.
What is the InChIKey of (3S)-2,2-dimethylnon-4-yn-3-ol?
The InChIKey is SDKKYLSROCBCSF-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H20O/c1-5-6-7-8-9-10(12)11(2,3)4/h10,12H,5-7H2,1-4H3/t10-/m1/s1.
What are the key properties of (3S)-2,2-dimethylnon-4-yn-3-ol?
(3S)-2,2-dimethylnon-4-yn-3-ol has a molecular weight of 168.28 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,2-dimethylnon-4-yn-3-ol is sourced from PubChem (CID 13213901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).