About 4-oxooctane-1,1,2,2-tetracarbonitrile
4-oxooctane-1,1,2,2-tetracarbonitrile (PubChem CID 13214271) has the molecular formula C12H12N4O
and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-oxooctane-1,1,2,2-tetracarbonitrile.
Molecular Properties
| Compound Name | 4-oxooctane-1,1,2,2-tetracarbonitrile |
| PubChem CID | 13214271 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-oxooctane-1,1,2,2-tetracarbonitrile |
| SMILES | CCCCC(=O)CC(C#N)(C#N)C(C#N)C#N |
| InChI | InChI=1S/C12H12N4O/c1-2-3-4-11(17)5-12(8-15,9-16)10(6-13)7-14/h10H,2-5H2,1H3 |
| InChIKey | URRUFMZKVMFQFF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 112.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|
Analyze 4-oxooctane-1,1,2,2-tetracarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxooctane-1,1,2,2-tetracarbonitrile?
The IUPAC name of 4-oxooctane-1,1,2,2-tetracarbonitrile (CID 13214271) is 4-oxooctane-1,1,2,2-tetracarbonitrile.
What is the SMILES notation for 4-oxooctane-1,1,2,2-tetracarbonitrile?
The canonical SMILES for 4-oxooctane-1,1,2,2-tetracarbonitrile is CCCCC(=O)CC(C#N)(C#N)C(C#N)C#N.
What is the InChIKey of 4-oxooctane-1,1,2,2-tetracarbonitrile?
The InChIKey is URRUFMZKVMFQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O/c1-2-3-4-11(17)5-12(8-15,9-16)10(6-13)7-14/h10H,2-5H2,1H3.
What are the key properties of 4-oxooctane-1,1,2,2-tetracarbonitrile?
4-oxooctane-1,1,2,2-tetracarbonitrile has a molecular weight of 228.25 g/mol, XLogP of 1.83, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxooctane-1,1,2,2-tetracarbonitrile is sourced from PubChem (CID 13214271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).