About 3-[(9,10-dioxoanthracen-2-yl)amino]butanal
3-[(9,10-dioxoanthracen-2-yl)amino]butanal (PubChem CID 13214483) has the molecular formula C18H15NO3
and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-[(9,10-dioxoanthracen-2-yl)amino]butanal.
Molecular Properties
| Compound Name | 3-[(9,10-dioxoanthracen-2-yl)amino]butanal |
| PubChem CID | 13214483 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-[(9,10-dioxoanthracen-2-yl)amino]butanal |
| SMILES | CC(CC=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H15NO3/c1-11(8-9-20)19-12-6-7-15-16(10-12)18(22)14-5-3-2-4-13(14)17(15)21/h2-7,9-11,19H,8H2,1H3 |
| InChIKey | AOIVYKMIUNFQPM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(9,10-dioxoanthracen-2-yl)amino]butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(9,10-dioxoanthracen-2-yl)amino]butanal?
The IUPAC name of 3-[(9,10-dioxoanthracen-2-yl)amino]butanal (CID 13214483) is 3-[(9,10-dioxoanthracen-2-yl)amino]butanal.
What is the SMILES notation for 3-[(9,10-dioxoanthracen-2-yl)amino]butanal?
The canonical SMILES for 3-[(9,10-dioxoanthracen-2-yl)amino]butanal is CC(CC=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of 3-[(9,10-dioxoanthracen-2-yl)amino]butanal?
The InChIKey is AOIVYKMIUNFQPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3/c1-11(8-9-20)19-12-6-7-15-16(10-12)18(22)14-5-3-2-4-13(14)17(15)21/h2-7,9-11,19H,8H2,1H3.
What are the key properties of 3-[(9,10-dioxoanthracen-2-yl)amino]butanal?
3-[(9,10-dioxoanthracen-2-yl)amino]butanal has a molecular weight of 293.32 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(9,10-dioxoanthracen-2-yl)amino]butanal is sourced from PubChem (CID 13214483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).