C9H13N5 — CID 13214577
N'-(4-cyano-1-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide (PubChem CID 13214577) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is N'-(4-cyano-1-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4-cyano-1-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 13214577 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N'-(4-cyano-1-ethylpyrazol-3-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCn1cc(C#N)c(/N=C/N(C)C)n1 |
| InChI | InChI=1S/C9H13N5/c1-4-14-6-8(5-10)9(12-14)11-7-13(2)3/h6-7H,4H2,1-3H3/b11-7+ |
| InChIKey | RPXHBALLBAWEPN-YRNVUSSQSA-N |
| XLogP | 1.00 |
| TPSA | 57.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|