C10H9NO2Se — CID 13214781
3-methyl-5-phenyl-1,3-selenazolidine-2,4-dione (PubChem CID 13214781) has the molecular formula C10H9NO2Se and a molecular weight of 254.15 g/mol. Its IUPAC name is 3-methyl-5-phenyl-1,3-selenazolidine-2,4-dione.
| Compound Name | 3-methyl-5-phenyl-1,3-selenazolidine-2,4-dione |
|---|---|
| PubChem CID | 13214781 |
| Molecular Formula | C10H9NO2Se |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 3-methyl-5-phenyl-1,3-selenazolidine-2,4-dione |
| SMILES | CN1C(=O)[Se]C(c2ccccc2)C1=O |
| InChI | InChI=1S/C10H9NO2Se/c1-11-9(12)8(14-10(11)13)7-5-3-2-4-6-7/h2-6,8H,1H3 |
| InChIKey | KJNYFWCNFSZCFK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|