C16H12N4 — CID 13214963
(1R,2S,5R,8R)-tetracyclo[6.2.1.12,5.01,6]dodec-6-ene-9,9,10,10-tetracarbonitrile (PubChem CID 13214963) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is (1R,2S,5R,8R)-tetracyclo[6.2.1.12,5.01,6]dodec-6-ene-9,9,10,10-tetracarbonitrile.
| Compound Name | (1R,2S,5R,8R)-tetracyclo[6.2.1.12,5.01,6]dodec-6-ene-9,9,10,10-tetracarbonitrile |
|---|---|
| PubChem CID | 13214963 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (1R,2S,5R,8R)-tetracyclo[6.2.1.12,5.01,6]dodec-6-ene-9,9,10,10-tetracarbonitrile |
| SMILES | N#CC1(C#N)[C@H]2C=C3[C@@H]4CC[C@@H](C4)[C@@]3(C2)C1(C#N)C#N |
| InChI | InChI=1S/C16H12N4/c17-6-14(7-18)12-4-13-10-1-2-11(3-10)16(13,5-12)15(14,8-19)9-20/h4,10-12H,1-3,5H2/t10-,11+,12+,16-/m1/s1 |
| InChIKey | KIIXCFLMWLNTRG-KZTGVZKYSA-N |
| XLogP | 2.43 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|