About 1,2-dimethyl-2,5-dihydrophosphole
1,2-dimethyl-2,5-dihydrophosphole (PubChem CID 13214995) has the molecular formula C6H11P
and a molecular weight of 114.13 g/mol. Its IUPAC name is 1,2-dimethyl-2,5-dihydrophosphole.
Molecular Properties
| Compound Name | 1,2-dimethyl-2,5-dihydrophosphole |
| PubChem CID | 13214995 |
| Molecular Formula | C6H11P |
| Molecular Weight | 114.13 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | 1,2-dimethyl-2,5-dihydrophosphole |
| SMILES | CC1C=CCP1C |
| InChI | InChI=1S/C6H11P/c1-6-4-3-5-7(6)2/h3-4,6H,5H2,1-2H3 |
| InChIKey | ULFWJUZDMLKAGS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.13 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-2,5-dihydrophosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-2,5-dihydrophosphole?
The IUPAC name of 1,2-dimethyl-2,5-dihydrophosphole (CID 13214995) is 1,2-dimethyl-2,5-dihydrophosphole.
What is the SMILES notation for 1,2-dimethyl-2,5-dihydrophosphole?
The canonical SMILES for 1,2-dimethyl-2,5-dihydrophosphole is CC1C=CCP1C.
What is the InChIKey of 1,2-dimethyl-2,5-dihydrophosphole?
The InChIKey is ULFWJUZDMLKAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11P/c1-6-4-3-5-7(6)2/h3-4,6H,5H2,1-2H3.
What are the key properties of 1,2-dimethyl-2,5-dihydrophosphole?
1,2-dimethyl-2,5-dihydrophosphole has a molecular weight of 114.13 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-2,5-dihydrophosphole is sourced from PubChem (CID 13214995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).