About 3-hydroxy-N,N-dimethyl-2-phenylpropanamide
3-hydroxy-N,N-dimethyl-2-phenylpropanamide (PubChem CID 13215117) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethyl-2-phenylpropanamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,N-dimethyl-2-phenylpropanamide |
| PubChem CID | 13215117 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-hydroxy-N,N-dimethyl-2-phenylpropanamide |
| SMILES | CN(C)C(=O)C(CO)c1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-12(2)11(14)10(8-13)9-6-4-3-5-7-9/h3-7,10,13H,8H2,1-2H3 |
| InChIKey | NZEZYCMMBLIPHG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-N,N-dimethyl-2-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,N-dimethyl-2-phenylpropanamide?
The IUPAC name of 3-hydroxy-N,N-dimethyl-2-phenylpropanamide (CID 13215117) is 3-hydroxy-N,N-dimethyl-2-phenylpropanamide.
What is the SMILES notation for 3-hydroxy-N,N-dimethyl-2-phenylpropanamide?
The canonical SMILES for 3-hydroxy-N,N-dimethyl-2-phenylpropanamide is CN(C)C(=O)C(CO)c1ccccc1.
What is the InChIKey of 3-hydroxy-N,N-dimethyl-2-phenylpropanamide?
The InChIKey is NZEZYCMMBLIPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-12(2)11(14)10(8-13)9-6-4-3-5-7-9/h3-7,10,13H,8H2,1-2H3.
What are the key properties of 3-hydroxy-N,N-dimethyl-2-phenylpropanamide?
3-hydroxy-N,N-dimethyl-2-phenylpropanamide has a molecular weight of 193.25 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,N-dimethyl-2-phenylpropanamide is sourced from PubChem (CID 13215117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).