C12H20O — CID 13215975
(1E,3E)-1-methoxy-4,8-dimethylnona-1,3,7-triene (PubChem CID 13215975) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1E,3E)-1-methoxy-4,8-dimethylnona-1,3,7-triene.
| Compound Name | (1E,3E)-1-methoxy-4,8-dimethylnona-1,3,7-triene |
|---|---|
| PubChem CID | 13215975 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1E,3E)-1-methoxy-4,8-dimethylnona-1,3,7-triene |
| SMILES | CO/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H20O/c1-11(2)7-5-8-12(3)9-6-10-13-4/h6-7,9-10H,5,8H2,1-4H3/b10-6+,12-9+ |
| InChIKey | DIBMNQKTTWIIFH-KOOBJXAQSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|