C22H23N3O6S2 — CID 1321618
N-[4-[[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 1321618) has the molecular formula C22H23N3O6S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[4-[[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 1321618 |
| Molecular Formula | C22H23N3O6S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-[4-[[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(C)cc1NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O6S2/c1-15-4-13-22(31-3)21(14-15)25-33(29,30)20-11-7-18(8-12-20)24-32(27,28)19-9-5-17(6-10-19)23-16(2)26/h4-14,24-25H,1-3H3,(H,23,26) |
| InChIKey | KIMPDKVUXNPOBG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |