About 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium
1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium (PubChem CID 13216386) has the molecular formula C8H10NS2+
and a molecular weight of 184.31 g/mol. Its IUPAC name is 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium |
| PubChem CID | 13216386 |
| Molecular Formula | C8H10NS2+ |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium |
| SMILES | CC[n+]1c(C)sc2sccc21 |
| InChI | InChI=1S/C8H10NS2/c1-3-9-6(2)11-8-7(9)4-5-10-8/h4-5H,3H2,1-2H3/q+1 |
| InChIKey | AKMXGMLOCSEMPD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium?
The IUPAC name of 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium (CID 13216386) is 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium.
What is the SMILES notation for 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium?
The canonical SMILES for 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium is CC[n+]1c(C)sc2sccc21.
What is the InChIKey of 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium?
The InChIKey is AKMXGMLOCSEMPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NS2/c1-3-9-6(2)11-8-7(9)4-5-10-8/h4-5H,3H2,1-2H3/q+1.
What are the key properties of 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium?
1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium has a molecular weight of 184.31 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methylthieno[3,2-d][1,3]thiazol-1-ium is sourced from PubChem (CID 13216386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).