About 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione
6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 1321643) has the molecular formula C19H17N3O3S
and a molecular weight of 367.43 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione |
| PubChem CID | 1321643 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(/C=N/c2ccccc2Sc2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H17N3O3S/c1-21-17(23)14(18(24)22(2)19(21)25)12-20-15-10-6-7-11-16(15)26-13-8-4-3-5-9-13/h3-12,23H,1-2H3/b20-12+ |
| InChIKey | GJGJMGOGYPWKJI-UDWIEESQSA-N |
| XLogP | 2.69 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione?
The IUPAC name of 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione (CID 1321643) is 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione.
What is the SMILES notation for 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione?
The canonical SMILES for 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione is Cn1c(O)c(/C=N/c2ccccc2Sc2ccccc2)c(=O)n(C)c1=O.
What is the InChIKey of 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione?
The InChIKey is GJGJMGOGYPWKJI-UDWIEESQSA-N. The full InChI is InChI=1S/C19H17N3O3S/c1-21-17(23)14(18(24)22(2)19(21)25)12-20-15-10-6-7-11-16(15)26-13-8-4-3-5-9-13/h3-12,23H,1-2H3/b20-12+.
What are the key properties of 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione?
6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione has a molecular weight of 367.43 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,3-dimethyl-5-[(2-phenylsulfanylphenyl)iminomethyl]pyrimidine-2,4-dione is sourced from PubChem (CID 1321643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).