C15H21N5O — CID 13217345
1,2-dimethyl-3-[[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl]guanidine (PubChem CID 13217345) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 13217345 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1,2-dimethyl-3-[[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NC)NCc1ccc(C2=NNC(=O)CC2C)cc1 |
| InChI | InChI=1S/C15H21N5O/c1-10-8-13(21)19-20-14(10)12-6-4-11(5-7-12)9-18-15(16-2)17-3/h4-7,10H,8-9H2,1-3H3,(H,19,21)(H2,16,17,18) |
| InChIKey | CWONTXYTWQQTAA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|