C16H25N3O2S — CID 13217508
(2R,11bS)-N-(dimethylsulfamoyl)-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine (PubChem CID 13217508) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2R,11bS)-N-(dimethylsulfamoyl)-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine.
| Compound Name | (2R,11bS)-N-(dimethylsulfamoyl)-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
|---|---|
| PubChem CID | 13217508 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2R,11bS)-N-(dimethylsulfamoyl)-N-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
| SMILES | CN(C)S(=O)(=O)N(C)[C@@H]1CCN2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C16H25N3O2S/c1-17(2)22(20,21)18(3)14-9-11-19-10-8-13-6-4-5-7-15(13)16(19)12-14/h4-7,14,16H,8-12H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | CJQWRRFBKUKRFN-ZBFHGGJFSA-N |
| XLogP | 1.49 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |