About ethyl 2-methyl-4-oxobutanoate
ethyl 2-methyl-4-oxobutanoate (PubChem CID 13218106) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is ethyl 2-methyl-4-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 2-methyl-4-oxobutanoate |
| PubChem CID | 13218106 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | ethyl 2-methyl-4-oxobutanoate |
| SMILES | CCOC(=O)C(C)CC=O |
| InChI | InChI=1S/C7H12O3/c1-3-10-7(9)6(2)4-5-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | OPRPECIXNZNSTF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methyl-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-4-oxobutanoate?
The IUPAC name of ethyl 2-methyl-4-oxobutanoate (CID 13218106) is ethyl 2-methyl-4-oxobutanoate.
What is the SMILES notation for ethyl 2-methyl-4-oxobutanoate?
The canonical SMILES for ethyl 2-methyl-4-oxobutanoate is CCOC(=O)C(C)CC=O.
What is the InChIKey of ethyl 2-methyl-4-oxobutanoate?
The InChIKey is OPRPECIXNZNSTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-10-7(9)6(2)4-5-8/h5-6H,3-4H2,1-2H3.
What are the key properties of ethyl 2-methyl-4-oxobutanoate?
ethyl 2-methyl-4-oxobutanoate has a molecular weight of 144.17 g/mol, XLogP of 0.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-4-oxobutanoate is sourced from PubChem (CID 13218106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).