About 2-chloro-6-iodoaniline
2-chloro-6-iodoaniline (PubChem CID 13218925) has the molecular formula C6H5ClIN
and a molecular weight of 253.47 g/mol. Its IUPAC name is 2-chloro-6-iodoaniline.
Molecular Properties
| Compound Name | 2-chloro-6-iodoaniline |
| PubChem CID | 13218925 |
| Molecular Formula | C6H5ClIN |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 252.92 |
| IUPAC Name | 2-chloro-6-iodoaniline |
| SMILES | Nc1c(Cl)cccc1I |
| InChI | InChI=1S/C6H5ClIN/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 |
| InChIKey | UTFIHWOTCWJTGT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-iodoaniline?
The IUPAC name of 2-chloro-6-iodoaniline (CID 13218925) is 2-chloro-6-iodoaniline.
What is the SMILES notation for 2-chloro-6-iodoaniline?
The canonical SMILES for 2-chloro-6-iodoaniline is Nc1c(Cl)cccc1I.
What is the InChIKey of 2-chloro-6-iodoaniline?
The InChIKey is UTFIHWOTCWJTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClIN/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2.
What are the key properties of 2-chloro-6-iodoaniline?
2-chloro-6-iodoaniline has a molecular weight of 253.47 g/mol, XLogP of 2.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-iodoaniline is sourced from PubChem (CID 13218925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).