C15H22O3Si2 — CID 13219766
trimethyl-[4-(2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decan-1-yl)phenyl]silane (PubChem CID 13219766) has the molecular formula C15H22O3Si2 and a molecular weight of 306.51 g/mol. Its IUPAC name is trimethyl-[4-(2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decan-1-yl)phenyl]silane.
| Compound Name | trimethyl-[4-(2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decan-1-yl)phenyl]silane |
|---|---|
| PubChem CID | 13219766 |
| Molecular Formula | C15H22O3Si2 |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | trimethyl-[4-(2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decan-1-yl)phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc([Si]23OC4CC(CC(C4)O2)O3)cc1 |
| InChI | InChI=1S/C15H22O3Si2/c1-19(2,3)14-4-6-15(7-5-14)20-16-11-8-12(17-20)10-13(9-11)18-20/h4-7,11-13H,8-10H2,1-3H3 |
| InChIKey | QEVVCEUKKSQUGZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|