C14H14O3 — CID 13220238
5-hydroxy-4-methyl-2,3,7,8-tetrahydro-1H-cyclopenta[a]naphthalene-6,9-dione (PubChem CID 13220238) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 5-hydroxy-4-methyl-2,3,7,8-tetrahydro-1H-cyclopenta[a]naphthalene-6,9-dione.
| Compound Name | 5-hydroxy-4-methyl-2,3,7,8-tetrahydro-1H-cyclopenta[a]naphthalene-6,9-dione |
|---|---|
| PubChem CID | 13220238 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-hydroxy-4-methyl-2,3,7,8-tetrahydro-1H-cyclopenta[a]naphthalene-6,9-dione |
| SMILES | Cc1c(O)c2c(c3c1CCC3)C(=O)CCC2=O |
| InChI | InChI=1S/C14H14O3/c1-7-8-3-2-4-9(8)12-10(15)5-6-11(16)13(12)14(7)17/h17H,2-6H2,1H3 |
| InChIKey | GWUCUPHLNBGCEY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|