C20H20ClFN4O5S — CID 132203319
Tas1553 (PubChem CID 132203319) has the molecular formula C20H20ClFN4O5S and a molecular weight of 482.90 g/mol. Its IUPAC name is 5-chloro-2-[[(1S,2R)-2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]sulfamoyl]benzamide.
| Compound Name | Tas1553 |
|---|---|
| PubChem CID | 132203319 |
| Molecular Formula | C20H20ClFN4O5S |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 5-chloro-2-[[(1S,2R)-2-(6-fluoro-2,3-dimethylphenyl)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)propyl]sulfamoyl]benzamide |
| SMILES | CC1=C(C(=C(C=C1)F)[C@@H](C)[C@@H](C2=NNC(=O)O2)NS(=O)(=O)C3=C(C=C(C=C3)Cl)C(=O)N)C |
| InChI | InChI=1S/C20H20ClFN4O5S/c1-9-4-6-14(22)16(10(9)2)11(3)17(19-24-25-20(28)31-19)26-32(29,30)15-7-5-12(21)8-13(15)18(23)27/h4-8,11,17,26H,1-3H3,(H2,23,27)(H,25,28)/t11-,17+/m1/s1 |
| InChIKey | DUYRWEBTZNUILI-DIFFPNOSSA-N |
| XLogP | 3.10 |
| TPSA | 148.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | 867 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |