C21H18O4 — CID 13220457
(2R,4S)-2-methoxy-2-methyl-4-phenyl-3,4-dihydrobenzo[g]chromene-5,10-dione (PubChem CID 13220457) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is (2R,4S)-2-methoxy-2-methyl-4-phenyl-3,4-dihydrobenzo[g]chromene-5,10-dione.
| Compound Name | (2R,4S)-2-methoxy-2-methyl-4-phenyl-3,4-dihydrobenzo[g]chromene-5,10-dione |
|---|---|
| PubChem CID | 13220457 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (2R,4S)-2-methoxy-2-methyl-4-phenyl-3,4-dihydrobenzo[g]chromene-5,10-dione |
| SMILES | CO[C@@]1(C)C[C@@H](c2ccccc2)C2=C(O1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H18O4/c1-21(24-2)12-16(13-8-4-3-5-9-13)17-18(22)14-10-6-7-11-15(14)19(23)20(17)25-21/h3-11,16H,12H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | HQRHGEQSNPLNIS-HRAATJIYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|