C16H15NO3 — CID 13220904
5-acetyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 13220904) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-acetyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 5-acetyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 13220904 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 5-acetyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(=O)C1=CCC2C(=O)N(c3ccccc3)C(=O)C2C1 |
| InChI | InChI=1S/C16H15NO3/c1-10(18)11-7-8-13-14(9-11)16(20)17(15(13)19)12-5-3-2-4-6-12/h2-7,13-14H,8-9H2,1H3 |
| InChIKey | MJUSECIWOQOMPD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|