About N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide
N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide (PubChem CID 13221217) has the molecular formula C6H8N4O3
and a molecular weight of 184.16 g/mol. Its IUPAC name is N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide |
| PubChem CID | 13221217 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide |
| SMILES | CC(=O)Nc1c(N)c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C6H8N4O3/c1-2(11)8-4-3(7)5(12)9-10-6(4)13/h1H3,(H3,7,10,13)(H2,8,9,11,12) |
| InChIKey | SEJFKIVPWVAMBF-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide?
The IUPAC name of N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide (CID 13221217) is N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide.
What is the SMILES notation for N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide?
The canonical SMILES for N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide is CC(=O)Nc1c(N)c(=O)[nH][nH]c1=O.
What is the InChIKey of N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide?
The InChIKey is SEJFKIVPWVAMBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O3/c1-2(11)8-4-3(7)5(12)9-10-6(4)13/h1H3,(H3,7,10,13)(H2,8,9,11,12).
What are the key properties of N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide?
N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide has a molecular weight of 184.16 g/mol, XLogP of -1.40, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-3,6-dioxo-1,2-dihydropyridazin-4-yl)acetamide is sourced from PubChem (CID 13221217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).