About phenyl N-sulfanylidenecarbamate
phenyl N-sulfanylidenecarbamate (PubChem CID 13221372) has the molecular formula C7H5NO2S
and a molecular weight of 167.19 g/mol. Its IUPAC name is phenyl N-sulfanylidenecarbamate.
Molecular Properties
| Compound Name | phenyl N-sulfanylidenecarbamate |
| PubChem CID | 13221372 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | phenyl N-sulfanylidenecarbamate |
| SMILES | O=C(N=S)Oc1ccccc1 |
| InChI | InChI=1S/C7H5NO2S/c9-7(8-11)10-6-4-2-1-3-5-6/h1-5H |
| InChIKey | LHUNTIHZLBVJKW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl N-sulfanylidenecarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-sulfanylidenecarbamate?
The IUPAC name of phenyl N-sulfanylidenecarbamate (CID 13221372) is phenyl N-sulfanylidenecarbamate.
What is the SMILES notation for phenyl N-sulfanylidenecarbamate?
The canonical SMILES for phenyl N-sulfanylidenecarbamate is O=C(N=S)Oc1ccccc1.
What is the InChIKey of phenyl N-sulfanylidenecarbamate?
The InChIKey is LHUNTIHZLBVJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S/c9-7(8-11)10-6-4-2-1-3-5-6/h1-5H.
What are the key properties of phenyl N-sulfanylidenecarbamate?
phenyl N-sulfanylidenecarbamate has a molecular weight of 167.19 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-sulfanylidenecarbamate is sourced from PubChem (CID 13221372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).