C14H18FNO2 — CID 132220333
US10214537, Example 153 (PubChem CID 132220333) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is (3-fluorophenyl)-[(2S,4R)-4-hydroxy-2-propan-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | US10214537, Example 153 |
|---|---|
| PubChem CID | 132220333 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (3-fluorophenyl)-[(2S,4R)-4-hydroxy-2-propan-2-ylpyrrolidin-1-yl]methanone |
| SMILES | CC(C)[C@@H]1C[C@H](CN1C(=O)C2=CC(=CC=C2)F)O |
| InChI | InChI=1S/C14H18FNO2/c1-9(2)13-7-12(17)8-16(13)14(18)10-4-3-5-11(15)6-10/h3-6,9,12-13,17H,7-8H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | XVAGLDLFVFDFOA-OLZOCXBDSA-N |
| XLogP | 2.40 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 308 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |