Cl10Si5 — CID 13222372
1,1,2,2,3,3,4,4,5,5-Decachloropentasilane (PubChem CID 13222372) has the molecular formula Cl10Si5 and a molecular weight of 494.96 g/mol.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-Decachloropentasilane |
|---|---|
| PubChem CID | 13222372 |
| Molecular Formula | Cl10Si5 |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 489.57 |
| IUPAC Name | — |
| SMILES | Cl[Si](Cl)[Si](Cl)(Cl)[Si](Cl)(Cl)[Si](Cl)(Cl)[Si](Cl)Cl |
| InChI | InChI=1S/Cl10Si5/c1-11(2)13(5,6)15(9,10)14(7,8)12(3)4 |
| InChIKey | FNYGQDUNJWEVAZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|