About triethyl(3,3,3-trifluoropropyl)silane
triethyl(3,3,3-trifluoropropyl)silane (PubChem CID 13222388) has the molecular formula C9H19F3Si
and a molecular weight of 212.33 g/mol. Its IUPAC name is triethyl(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | triethyl(3,3,3-trifluoropropyl)silane |
| PubChem CID | 13222388 |
| Molecular Formula | C9H19F3Si |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | triethyl(3,3,3-trifluoropropyl)silane |
| SMILES | CC[Si](CC)(CC)CCC(F)(F)F |
| InChI | InChI=1S/C9H19F3Si/c1-4-13(5-2,6-3)8-7-9(10,11)12/h4-8H2,1-3H3 |
| InChIKey | PBSBBHBNTCAEBY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(3,3,3-trifluoropropyl)silane?
The IUPAC name of triethyl(3,3,3-trifluoropropyl)silane (CID 13222388) is triethyl(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for triethyl(3,3,3-trifluoropropyl)silane?
The canonical SMILES for triethyl(3,3,3-trifluoropropyl)silane is CC[Si](CC)(CC)CCC(F)(F)F.
What is the InChIKey of triethyl(3,3,3-trifluoropropyl)silane?
The InChIKey is PBSBBHBNTCAEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3Si/c1-4-13(5-2,6-3)8-7-9(10,11)12/h4-8H2,1-3H3.
What are the key properties of triethyl(3,3,3-trifluoropropyl)silane?
triethyl(3,3,3-trifluoropropyl)silane has a molecular weight of 212.33 g/mol, XLogP of 4.45, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 13222388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).