About dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane
dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane (PubChem CID 13222398) has the molecular formula C4H7Cl2F3Si
and a molecular weight of 211.09 g/mol. Its IUPAC name is dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane.
Molecular Properties
| Compound Name | dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane |
| PubChem CID | 13222398 |
| Molecular Formula | C4H7Cl2F3Si |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 209.96 |
| IUPAC Name | dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane |
| SMILES | CC(C(F)(F)F)[Si](C)(Cl)Cl |
| InChI | InChI=1S/C4H7Cl2F3Si/c1-3(4(7,8)9)10(2,5)6/h3H,1-2H3 |
| InChIKey | DQPMAASJNLLNIP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane?
The IUPAC name of dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane (CID 13222398) is dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane.
What is the SMILES notation for dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane?
The canonical SMILES for dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane is CC(C(F)(F)F)[Si](C)(Cl)Cl.
What is the InChIKey of dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane?
The InChIKey is DQPMAASJNLLNIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Cl2F3Si/c1-3(4(7,8)9)10(2,5)6/h3H,1-2H3.
What are the key properties of dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane?
dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane has a molecular weight of 211.09 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-methyl-(1,1,1-trifluoropropan-2-yl)silane is sourced from PubChem (CID 13222398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).