C5H7Cl2F5Si — CID 13222399
dichloro-methyl-(3,3,4,4,4-pentafluorobutan-2-yl)silane (PubChem CID 13222399) has the molecular formula C5H7Cl2F5Si and a molecular weight of 261.09 g/mol. Its IUPAC name is dichloro-methyl-(3,3,4,4,4-pentafluorobutan-2-yl)silane.
| Compound Name | dichloro-methyl-(3,3,4,4,4-pentafluorobutan-2-yl)silane |
|---|---|
| PubChem CID | 13222399 |
| Molecular Formula | C5H7Cl2F5Si |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | dichloro-methyl-(3,3,4,4,4-pentafluorobutan-2-yl)silane |
| SMILES | CC(C(F)(F)C(F)(F)F)[Si](C)(Cl)Cl |
| InChI | InChI=1S/C5H7Cl2F5Si/c1-3(13(2,6)7)4(8,9)5(10,11)12/h3H,1-2H3 |
| InChIKey | LOIXJQAXDZXOON-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|