About dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane
dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane (PubChem CID 13222401) has the molecular formula C6H13F3O2Si
and a molecular weight of 202.25 g/mol. Its IUPAC name is dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane.
Molecular Properties
| Compound Name | dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane |
| PubChem CID | 13222401 |
| Molecular Formula | C6H13F3O2Si |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane |
| SMILES | CO[Si](C)(OC)C(C)C(F)(F)F |
| InChI | InChI=1S/C6H13F3O2Si/c1-5(6(7,8)9)12(4,10-2)11-3/h5H,1-4H3 |
| InChIKey | BTJCEVZMRIJBSM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane?
The IUPAC name of dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane (CID 13222401) is dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane.
What is the SMILES notation for dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane?
The canonical SMILES for dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane is CO[Si](C)(OC)C(C)C(F)(F)F.
What is the InChIKey of dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane?
The InChIKey is BTJCEVZMRIJBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3O2Si/c1-5(6(7,8)9)12(4,10-2)11-3/h5H,1-4H3.
What are the key properties of dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane?
dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane has a molecular weight of 202.25 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-methyl-(1,1,1-trifluoropropan-2-yl)silane is sourced from PubChem (CID 13222401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).