C10H17FO — CID 13222567
2-fluoro-3,3,5,5-tetramethylcyclohexan-1-one (PubChem CID 13222567) has the molecular formula C10H17FO and a molecular weight of 172.24 g/mol. Its IUPAC name is 2-fluoro-3,3,5,5-tetramethylcyclohexan-1-one.
| Compound Name | 2-fluoro-3,3,5,5-tetramethylcyclohexan-1-one |
|---|---|
| PubChem CID | 13222567 |
| Molecular Formula | C10H17FO |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-fluoro-3,3,5,5-tetramethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(F)C(C)(C)C1 |
| InChI | InChI=1S/C10H17FO/c1-9(2)5-7(12)8(11)10(3,4)6-9/h8H,5-6H2,1-4H3 |
| InChIKey | SZZGHHZYWKBRIY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |