C15H23ClN2O4 — CID 13222942
(3S,4R)-4-(diethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride (PubChem CID 13222942) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is (3S,4R)-4-(diethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride.
| Compound Name | (3S,4R)-4-(diethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride |
|---|---|
| PubChem CID | 13222942 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (3S,4R)-4-(diethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride |
| SMILES | CCN(CC)[C@@H]1c2cc([N+](=O)[O-])ccc2OC(C)(C)[C@H]1O.Cl |
| InChI | InChI=1S/C15H22N2O4.ClH/c1-5-16(6-2)13-11-9-10(17(19)20)7-8-12(11)21-15(3,4)14(13)18;/h7-9,13-14,18H,5-6H2,1-4H3;1H/t13-,14+;/m1./s1 |
| InChIKey | NUNFMRMESJVWPG-DFQHDRSWSA-N |
| XLogP | 2.93 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|