C17H26N2O7S — CID 13222969
(3S,4R)-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methanesulfonic acid (PubChem CID 13222969) has the molecular formula C17H26N2O7S and a molecular weight of 402.47 g/mol. Its IUPAC name is (3S,4R)-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methanesulfonic acid.
| Compound Name | (3S,4R)-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 13222969 |
| Molecular Formula | C17H26N2O7S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (3S,4R)-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methanesulfonic acid |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](N2CCCCC2)[C@@H]1O.CS(=O)(=O)O |
| InChI | InChI=1S/C16H22N2O4.CH4O3S/c1-16(2)15(19)14(17-8-4-3-5-9-17)12-10-11(18(20)21)6-7-13(12)22-16;1-5(2,3)4/h6-7,10,14-15,19H,3-5,8-9H2,1-2H3;1H3,(H,2,3,4)/t14-,15+;/m1./s1 |
| InChIKey | VHFKTOUDMGCKNS-LIOBNPLQSA-N |
| XLogP | 2.16 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|