C17H25ClN2O4 — CID 13222984
(3S,4R)-2,2-dimethyl-4-(4-methylpiperidin-1-yl)-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride (PubChem CID 13222984) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is (3S,4R)-2,2-dimethyl-4-(4-methylpiperidin-1-yl)-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride.
| Compound Name | (3S,4R)-2,2-dimethyl-4-(4-methylpiperidin-1-yl)-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride |
|---|---|
| PubChem CID | 13222984 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (3S,4R)-2,2-dimethyl-4-(4-methylpiperidin-1-yl)-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride |
| SMILES | CC1CCN([C@@H]2c3cc([N+](=O)[O-])ccc3OC(C)(C)[C@H]2O)CC1.Cl |
| InChI | InChI=1S/C17H24N2O4.ClH/c1-11-6-8-18(9-7-11)15-13-10-12(19(21)22)4-5-14(13)23-17(2,3)16(15)20;/h4-5,10-11,15-16,20H,6-9H2,1-3H3;1H/t15-,16+;/m1./s1 |
| InChIKey | PNBXKEIHWLRMHB-RCPFAERMSA-N |
| XLogP | 3.32 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|