C15H21ClN2O5 — CID 13222987
(3S,4R)-2,2-dimethyl-4-morpholin-4-yl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride (PubChem CID 13222987) has the molecular formula C15H21ClN2O5 and a molecular weight of 344.80 g/mol. Its IUPAC name is (3S,4R)-2,2-dimethyl-4-morpholin-4-yl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride.
| Compound Name | (3S,4R)-2,2-dimethyl-4-morpholin-4-yl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride |
|---|---|
| PubChem CID | 13222987 |
| Molecular Formula | C15H21ClN2O5 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (3S,4R)-2,2-dimethyl-4-morpholin-4-yl-6-nitro-3,4-dihydrochromen-3-ol;hydrochloride |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](N2CCOCC2)[C@@H]1O.Cl |
| InChI | InChI=1S/C15H20N2O5.ClH/c1-15(2)14(18)13(16-5-7-21-8-6-16)11-9-10(17(19)20)3-4-12(11)22-15;/h3-4,9,13-14,18H,5-8H2,1-2H3;1H/t13-,14+;/m1./s1 |
| InChIKey | DZFOQHLTNHPNAR-DFQHDRSWSA-N |
| XLogP | 1.92 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|