C21H26ClN3O4 — CID 13222990
(3S,4R)-2,2-dimethyl-6-nitro-4-(4-phenylpiperazin-1-yl)-3,4-dihydrochromen-3-ol;hydrochloride (PubChem CID 13222990) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is (3S,4R)-2,2-dimethyl-6-nitro-4-(4-phenylpiperazin-1-yl)-3,4-dihydrochromen-3-ol;hydrochloride.
| Compound Name | (3S,4R)-2,2-dimethyl-6-nitro-4-(4-phenylpiperazin-1-yl)-3,4-dihydrochromen-3-ol;hydrochloride |
|---|---|
| PubChem CID | 13222990 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3S,4R)-2,2-dimethyl-6-nitro-4-(4-phenylpiperazin-1-yl)-3,4-dihydrochromen-3-ol;hydrochloride |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](N2CCN(c3ccccc3)CC2)[C@@H]1O.Cl |
| InChI | InChI=1S/C21H25N3O4.ClH/c1-21(2)20(25)19(17-14-16(24(26)27)8-9-18(17)28-21)23-12-10-22(11-13-23)15-6-4-3-5-7-15;/h3-9,14,19-20,25H,10-13H2,1-2H3;1H/t19-,20+;/m1./s1 |
| InChIKey | IOZDQEOJBIVZDL-FDOHDBATSA-N |
| XLogP | 3.41 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|