C8H8N4OS — CID 13223441
5-(2,4-dimethylpyrimidin-5-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 13223441) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 5-(2,4-dimethylpyrimidin-5-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2,4-dimethylpyrimidin-5-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 13223441 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 5-(2,4-dimethylpyrimidin-5-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ncc(-c2n[nH]c(=S)o2)c(C)n1 |
| InChI | InChI=1S/C8H8N4OS/c1-4-6(3-9-5(2)10-4)7-11-12-8(14)13-7/h3H,1-2H3,(H,12,14) |
| InChIKey | CZPRNBIZYZZGIV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|