About [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane
[(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane (PubChem CID 13223791) has the molecular formula C9H18F2Si
and a molecular weight of 192.32 g/mol. Its IUPAC name is [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane |
| PubChem CID | 13223791 |
| Molecular Formula | C9H18F2Si |
| Molecular Weight | 192.32 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane |
| SMILES | CC(C)(C)/C(F)=C(\F)[Si](C)(C)C |
| InChI | InChI=1S/C9H18F2Si/c1-9(2,3)7(10)8(11)12(4,5)6/h1-6H3/b8-7- |
| InChIKey | BMAWYYMBVMCIIG-FPLPWBNLSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane?
The IUPAC name of [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane (CID 13223791) is [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane.
What is the SMILES notation for [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane?
The canonical SMILES for [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane is CC(C)(C)/C(F)=C(\F)[Si](C)(C)C.
What is the InChIKey of [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane?
The InChIKey is BMAWYYMBVMCIIG-FPLPWBNLSA-N. The full InChI is InChI=1S/C9H18F2Si/c1-9(2,3)7(10)8(11)12(4,5)6/h1-6H3/b8-7-.
What are the key properties of [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane?
[(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane has a molecular weight of 192.32 g/mol, XLogP of 4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,2-difluoro-3,3-dimethylbut-1-enyl]-trimethylsilane is sourced from PubChem (CID 13223791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).