About 3-cyclohexyl-2,5-diphenyl-1H-pyrrole
3-cyclohexyl-2,5-diphenyl-1H-pyrrole (PubChem CID 13223945) has the molecular formula C22H23N
and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-cyclohexyl-2,5-diphenyl-1H-pyrrole.
Molecular Properties
| Compound Name | 3-cyclohexyl-2,5-diphenyl-1H-pyrrole |
| PubChem CID | 13223945 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-cyclohexyl-2,5-diphenyl-1H-pyrrole |
| SMILES | c1ccc(-c2cc(C3CCCCC3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C22H23N/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23-22(20)19-14-8-3-9-15-19/h2-3,6-9,12-17,23H,1,4-5,10-11H2 |
| InChIKey | BGLDWXRXXMFGOT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-cyclohexyl-2,5-diphenyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-2,5-diphenyl-1H-pyrrole?
The IUPAC name of 3-cyclohexyl-2,5-diphenyl-1H-pyrrole (CID 13223945) is 3-cyclohexyl-2,5-diphenyl-1H-pyrrole.
What is the SMILES notation for 3-cyclohexyl-2,5-diphenyl-1H-pyrrole?
The canonical SMILES for 3-cyclohexyl-2,5-diphenyl-1H-pyrrole is c1ccc(-c2cc(C3CCCCC3)c(-c3ccccc3)[nH]2)cc1.
What is the InChIKey of 3-cyclohexyl-2,5-diphenyl-1H-pyrrole?
The InChIKey is BGLDWXRXXMFGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23-22(20)19-14-8-3-9-15-19/h2-3,6-9,12-17,23H,1,4-5,10-11H2.
What are the key properties of 3-cyclohexyl-2,5-diphenyl-1H-pyrrole?
3-cyclohexyl-2,5-diphenyl-1H-pyrrole has a molecular weight of 301.43 g/mol, XLogP of 6.40, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-2,5-diphenyl-1H-pyrrole is sourced from PubChem (CID 13223945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).