About 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol
2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol (PubChem CID 13224226) has the molecular formula C21H13FN4O7
and a molecular weight of 452.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol |
| PubChem CID | 13224226 |
| Molecular Formula | C21H13FN4O7 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol |
| SMILES | Fc1ccc(-c2ccc3ccccc3n2)cc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10FN.C6H3N3O7/c16-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)17-15;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-10H;1-2,10H |
| InChIKey | IZWJFBVBBVSBTL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol?
The IUPAC name of 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol (CID 13224226) is 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol.
What is the SMILES notation for 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol?
The canonical SMILES for 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol is Fc1ccc(-c2ccc3ccccc3n2)cc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.
What is the InChIKey of 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol?
The InChIKey is IZWJFBVBBVSBTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN.C6H3N3O7/c16-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)17-15;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-10H;1-2,10H.
What are the key properties of 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol?
2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol has a molecular weight of 452.35 g/mol, XLogP of 5.16, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)quinoline;2,4,6-trinitrophenol is sourced from PubChem (CID 13224226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).