C21H9F5N4O7 — CID 13224233
2-(2,3,4,5,6-pentafluorophenyl)quinoline;2,4,6-trinitrophenol (PubChem CID 13224233) has the molecular formula C21H9F5N4O7 and a molecular weight of 524.31 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)quinoline;2,4,6-trinitrophenol.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)quinoline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 13224233 |
| Molecular Formula | C21H9F5N4O7 |
| Molecular Weight | 524.31 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)quinoline;2,4,6-trinitrophenol |
| SMILES | Fc1c(F)c(F)c(-c2ccc3ccccc3n2)c(F)c1F.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H6F5N.C6H3N3O7/c16-11-10(12(17)14(19)15(20)13(11)18)9-6-5-7-3-1-2-4-8(7)21-9;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-6H;1-2,10H |
| InChIKey | DENSQNWHMXQNBM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|