About 5-phenyl-1,2-selenazole
5-phenyl-1,2-selenazole (PubChem CID 13224790) has the molecular formula C9H7NSe
and a molecular weight of 208.12 g/mol. Its IUPAC name is 5-phenyl-1,2-selenazole.
Molecular Properties
| Compound Name | 5-phenyl-1,2-selenazole |
| PubChem CID | 13224790 |
| Molecular Formula | C9H7NSe |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.97 |
| IUPAC Name | 5-phenyl-1,2-selenazole |
| SMILES | c1ccc(-c2ccn[se]2)cc1 |
| InChI | InChI=1S/C9H7NSe/c1-2-4-8(5-3-1)9-6-7-10-11-9/h1-7H |
| InChIKey | RZKXXUSXNFYHLO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1,2-selenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,2-selenazole?
The IUPAC name of 5-phenyl-1,2-selenazole (CID 13224790) is 5-phenyl-1,2-selenazole.
What is the SMILES notation for 5-phenyl-1,2-selenazole?
The canonical SMILES for 5-phenyl-1,2-selenazole is c1ccc(-c2ccn[se]2)cc1.
What is the InChIKey of 5-phenyl-1,2-selenazole?
The InChIKey is RZKXXUSXNFYHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NSe/c1-2-4-8(5-3-1)9-6-7-10-11-9/h1-7H.
What are the key properties of 5-phenyl-1,2-selenazole?
5-phenyl-1,2-selenazole has a molecular weight of 208.12 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,2-selenazole is sourced from PubChem (CID 13224790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).