C10H18S — CID 13225231
2-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 13225231) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is 2-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | 2-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 13225231 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | CCC1CC2CCCCC2S1 |
| InChI | InChI=1S/C10H18S/c1-2-9-7-8-5-3-4-6-10(8)11-9/h8-10H,2-7H2,1H3 |
| InChIKey | SSVSXHDPTLELGC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |