About 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione
9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione (PubChem CID 13225507) has the molecular formula C18H11Cl2N3S
and a molecular weight of 372.28 g/mol. Its IUPAC name is 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione.
Molecular Properties
| Compound Name | 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione |
| PubChem CID | 13225507 |
| Molecular Formula | C18H11Cl2N3S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione |
| SMILES | S=c1ncc2c([nH]1)-c1ccc(Cl)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C18H11Cl2N3S/c19-11-5-6-12-14(7-11)17(13-3-1-2-4-15(13)20)21-8-10-9-22-18(24)23-16(10)12/h1-7,9H,8H2,(H,22,23,24) |
| InChIKey | IEVKAJOBHSHQDN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione?
The IUPAC name of 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione (CID 13225507) is 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione.
What is the SMILES notation for 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione?
The canonical SMILES for 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione is S=c1ncc2c([nH]1)-c1ccc(Cl)cc1C(c1ccccc1Cl)=NC2.
What is the InChIKey of 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione?
The InChIKey is IEVKAJOBHSHQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2N3S/c19-11-5-6-12-14(7-11)17(13-3-1-2-4-15(13)20)21-8-10-9-22-18(24)23-16(10)12/h1-7,9H,8H2,(H,22,23,24).
What are the key properties of 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione?
9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione has a molecular weight of 372.28 g/mol, XLogP of 5.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-7-(2-chlorophenyl)-1,5-dihydropyrimido[5,4-d][2]benzazepine-2-thione is sourced from PubChem (CID 13225507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).